C19H24N2O5 — CID 102050300
(4aR,6S,7R,8R,8aS)-6-(1,8-naphthyridin-2-ylmethyl)-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 102050300) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aS)-6-(1,8-naphthyridin-2-ylmethyl)-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aS)-6-(1,8-naphthyridin-2-ylmethyl)-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 102050300 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | (4aR,6S,7R,8R,8aS)-6-(1,8-naphthyridin-2-ylmethyl)-2-propyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CCCC1OC[C@H]2O[C@@H](Cc3ccc4cccnc4n3)[C@H](O)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C19H24N2O5/c1-2-4-15-24-10-14-18(26-15)17(23)16(22)13(25-14)9-12-7-6-11-5-3-8-20-19(11)21-12/h3,5-8,13-18,22-23H,2,4,9-10H2,1H3/t13-,14+,15?,16-,17+,18+/m0/s1 |
| InChIKey | RJWUVXDGGPLLGZ-DXMBWKHVSA-N |
| XLogP | 1.20 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |