C12H14N2O — CID 102050602
(4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one (PubChem CID 102050602) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one.
| Compound Name | (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 102050602 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one |
| SMILES | C=C[C@H]1C[C@@H](c2ccccc2)NC(=O)N1 |
| InChI | InChI=1S/C12H14N2O/c1-2-10-8-11(14-12(15)13-10)9-6-4-3-5-7-9/h2-7,10-11H,1,8H2,(H2,13,14,15)/t10-,11-/m0/s1 |
| InChIKey | DDQATCTWWVAMHJ-QWRGUYRKSA-N |
| XLogP | 1.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|