About (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one
(4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one (PubChem CID 102050602) has the molecular formula C12H14N2O
and a molecular weight of 202.26 g/mol. Its IUPAC name is (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one |
| PubChem CID | 102050602 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one |
| SMILES | C=C[C@H]1C[C@@H](c2ccccc2)NC(=O)N1 |
| InChI | InChI=1S/C12H14N2O/c1-2-10-8-11(14-12(15)13-10)9-6-4-3-5-7-9/h2-7,10-11H,1,8H2,(H2,13,14,15)/t10-,11-/m0/s1 |
| InChIKey | DDQATCTWWVAMHJ-QWRGUYRKSA-N |
| XLogP | 1.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one?
The IUPAC name of (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one (CID 102050602) is (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one.
What is the SMILES notation for (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one?
The canonical SMILES for (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one is C=C[C@H]1C[C@@H](c2ccccc2)NC(=O)N1.
What is the InChIKey of (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one?
The InChIKey is DDQATCTWWVAMHJ-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H14N2O/c1-2-10-8-11(14-12(15)13-10)9-6-4-3-5-7-9/h2-7,10-11H,1,8H2,(H2,13,14,15)/t10-,11-/m0/s1.
What are the key properties of (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one?
(4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one has a molecular weight of 202.26 g/mol, XLogP of 1.99, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,6S)-4-ethenyl-6-phenyl-1,3-diazinan-2-one is sourced from PubChem (CID 102050602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).