C24H33NO3Si — CID 102051093
(8R,9R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-8,10-dimethyl-2-azatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),3,5,12(16),13-pentaen-7-one (PubChem CID 102051093) has the molecular formula C24H33NO3Si and a molecular weight of 411.62 g/mol. Its IUPAC name is (8R,9R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-8,10-dimethyl-2-azatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),3,5,12(16),13-pentaen-7-one.
| Compound Name | (8R,9R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-8,10-dimethyl-2-azatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),3,5,12(16),13-pentaen-7-one |
|---|---|
| PubChem CID | 102051093 |
| Molecular Formula | C24H33NO3Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (8R,9R,10S,11S)-11-[tert-butyl(dimethyl)silyl]oxy-14-methoxy-8,10-dimethyl-2-azatetracyclo[7.6.1.02,6.012,16]hexadeca-1(15),3,5,12(16),13-pentaen-7-one |
| SMILES | COc1cc2c3c(c1)-n1cccc1C(=O)[C@H](C)[C@H]3[C@H](C)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H33NO3Si/c1-14-20-15(2)23(28-29(7,8)24(3,4)5)17-12-16(27-6)13-19(21(17)20)25-11-9-10-18(25)22(14)26/h9-15,20,23H,1-8H3/t14-,15+,20+,23+/m1/s1 |
| InChIKey | JRTBMZWPOJPONA-YOTMJQBJSA-N |
| XLogP | 6.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|