About 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane
8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane (PubChem CID 102051155) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane |
| PubChem CID | 102051155 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane |
| SMILES | CC#CC=C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H16O2/c1-2-3-4-11-5-7-12(8-6-11)13-9-10-14-12/h4H,5-10H2,1H3 |
| InChIKey | GIOKYIAHKQTAQQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane?
The IUPAC name of 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane (CID 102051155) is 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane.
What is the SMILES notation for 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane?
The canonical SMILES for 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane is CC#CC=C1CCC2(CC1)OCCO2.
What is the InChIKey of 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane?
The InChIKey is GIOKYIAHKQTAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-3-4-11-5-7-12(8-6-11)13-9-10-14-12/h4H,5-10H2,1H3.
What are the key properties of 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane?
8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane has a molecular weight of 192.26 g/mol, XLogP of 2.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-but-2-ynylidene-1,4-dioxaspiro[4.5]decane is sourced from PubChem (CID 102051155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).