C13H16O2 — CID 102051158
(2S,3R)-3-prop-2-enoxy-1,2,3,4-tetrahydronaphthalen-2-ol (PubChem CID 102051158) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2S,3R)-3-prop-2-enoxy-1,2,3,4-tetrahydronaphthalen-2-ol.
| Compound Name | (2S,3R)-3-prop-2-enoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 102051158 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2S,3R)-3-prop-2-enoxy-1,2,3,4-tetrahydronaphthalen-2-ol |
| SMILES | C=CCO[C@@H]1Cc2ccccc2C[C@@H]1O |
| InChI | InChI=1S/C13H16O2/c1-2-7-15-13-9-11-6-4-3-5-10(11)8-12(13)14/h2-6,12-14H,1,7-9H2/t12-,13+/m0/s1 |
| InChIKey | UYCGTIGTDNIYHT-QWHCGFSZSA-N |
| XLogP | 1.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|