C22H17ClN6O4 — CID 10205118
ethyl 15-chloro-9-[(4-nitrophenyl)methyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate (PubChem CID 10205118) has the molecular formula C22H17ClN6O4 and a molecular weight of 464.87 g/mol. Its IUPAC name is ethyl 15-chloro-9-[(4-nitrophenyl)methyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate.
| Compound Name | ethyl 15-chloro-9-[(4-nitrophenyl)methyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 10205118 |
| Molecular Formula | C22H17ClN6O4 |
| Molecular Weight | 464.87 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | ethyl 15-chloro-9-[(4-nitrophenyl)methyl]-2,4,8,10,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene-5-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cn1c(Cc3ccc([N+](=O)[O-])cc3)nnc1-c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C22H17ClN6O4/c1-2-33-22(30)20-18-11-27-19(9-13-3-6-15(7-4-13)29(31)32)25-26-21(27)16-10-14(23)5-8-17(16)28(18)12-24-20/h3-8,10,12H,2,9,11H2,1H3 |
| InChIKey | KRYSXAZZLYDGSG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.87 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|