C22H14Br2O2 — CID 102051426
(6R,13R)-2,3-dibromo-6,13-dihydropentacene-6,13-diol (PubChem CID 102051426) has the molecular formula C22H14Br2O2 and a molecular weight of 470.16 g/mol. Its IUPAC name is (6R,13R)-2,3-dibromo-6,13-dihydropentacene-6,13-diol.
| Compound Name | (6R,13R)-2,3-dibromo-6,13-dihydropentacene-6,13-diol |
|---|---|
| PubChem CID | 102051426 |
| Molecular Formula | C22H14Br2O2 |
| Molecular Weight | 470.16 g/mol |
| Exact Mass | 467.94 |
| IUPAC Name | (6R,13R)-2,3-dibromo-6,13-dihydropentacene-6,13-diol |
| SMILES | O[C@@H]1c2cc3ccccc3cc2[C@@H](O)c2cc3cc(Br)c(Br)cc3cc21 |
| InChI | InChI=1S/C22H14Br2O2/c23-19-9-13-7-17-18(8-14(13)10-20(19)24)22(26)16-6-12-4-2-1-3-11(12)5-15(16)21(17)25/h1-10,21-22,25-26H/t21-,22-/m1/s1 |
| InChIKey | DEHFFQTZJBPIGR-FGZHOGPDSA-N |
| XLogP | 5.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.16 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |