C15H12F3NO3 — CID 102051906
ethyl 6-oxo-5-phenyl-2-(trifluoromethyl)-1H-pyridine-3-carboxylate (PubChem CID 102051906) has the molecular formula C15H12F3NO3 and a molecular weight of 311.26 g/mol. Its IUPAC name is ethyl 6-oxo-5-phenyl-2-(trifluoromethyl)-1H-pyridine-3-carboxylate.
| Compound Name | ethyl 6-oxo-5-phenyl-2-(trifluoromethyl)-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102051906 |
| Molecular Formula | C15H12F3NO3 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 6-oxo-5-phenyl-2-(trifluoromethyl)-1H-pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)c(=O)[nH]c1C(F)(F)F |
| InChI | InChI=1S/C15H12F3NO3/c1-2-22-14(21)11-8-10(9-6-4-3-5-7-9)13(20)19-12(11)15(16,17)18/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | DJENYWCHSKMILX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |