About CID 102052496
CID 102052496 (PubChem CID 102052496) has the molecular formula C16H17
and a molecular weight of 209.31 g/mol.
Molecular Properties
| Compound Name | CID 102052496 |
| PubChem CID | 102052496 |
| Molecular Formula | C16H17 |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | — |
| SMILES | CC1=Cc2c(C)c3c(c(C)c2[CH]1)C=C(C)C3 |
| InChI | InChI=1S/C16H17/c1-9-5-13-11(3)15-7-10(2)8-16(15)12(4)14(13)6-9/h5-7H,8H2,1-4H3 |
| InChIKey | LGRHPAXTAFDEMG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 102052496 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102052496?
The IUPAC name of CID 102052496 (CID 102052496) is not available.
What is the SMILES notation for CID 102052496?
The canonical SMILES for CID 102052496 is CC1=Cc2c(C)c3c(c(C)c2[CH]1)C=C(C)C3.
What is the InChIKey of CID 102052496?
The InChIKey is LGRHPAXTAFDEMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17/c1-9-5-13-11(3)15-7-10(2)8-16(15)12(4)14(13)6-9/h5-7H,8H2,1-4H3.
What are the key properties of CID 102052496?
CID 102052496 has a molecular weight of 209.31 g/mol, XLogP of 4.23, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102052496 is sourced from PubChem (CID 102052496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).