About (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine
(2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine (PubChem CID 102052521) has the molecular formula C21H46N2
and a molecular weight of 326.61 g/mol. Its IUPAC name is (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine.
Molecular Properties
| Compound Name | (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine |
| PubChem CID | 102052521 |
| Molecular Formula | C21H46N2 |
| Molecular Weight | 326.61 g/mol |
| Exact Mass | 326.37 |
| IUPAC Name | (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H](N)C(C)C |
| InChI | InChI=1S/C21H46N2/c1-5-7-9-11-13-15-17-23(19-21(22)20(3)4)18-16-14-12-10-8-6-2/h20-21H,5-19,22H2,1-4H3/t21-/m1/s1 |
| InChIKey | BPQGPJOGKOEMSJ-OAQYLSRUSA-N |
| XLogP | 5.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.61 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine?
The IUPAC name of (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine (CID 102052521) is (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine.
What is the SMILES notation for (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine?
The canonical SMILES for (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine is CCCCCCCCN(CCCCCCCC)C[C@@H](N)C(C)C.
What is the InChIKey of (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine?
The InChIKey is BPQGPJOGKOEMSJ-OAQYLSRUSA-N. The full InChI is InChI=1S/C21H46N2/c1-5-7-9-11-13-15-17-23(19-21(22)20(3)4)18-16-14-12-10-8-6-2/h20-21H,5-19,22H2,1-4H3/t21-/m1/s1.
What are the key properties of (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine?
(2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine has a molecular weight of 326.61 g/mol, XLogP of 5.99, 17 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-methyl-1-N,1-N-dioctylbutane-1,2-diamine is sourced from PubChem (CID 102052521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).