About 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene
2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene (PubChem CID 102052845) has the molecular formula C19H12Br2
and a molecular weight of 400.11 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene.
Molecular Properties
| Compound Name | 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene |
| PubChem CID | 102052845 |
| Molecular Formula | C19H12Br2 |
| Molecular Weight | 400.11 g/mol |
| Exact Mass | 397.93 |
| IUPAC Name | 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene |
| SMILES | C#CCC1(CC#C)c2cc(Br)ccc2-c2ccc(Br)cc21 |
| InChI | InChI=1S/C19H12Br2/c1-3-9-19(10-4-2)17-11-13(20)5-7-15(17)16-8-6-14(21)12-18(16)19/h1-2,5-8,11-12H,9-10H2 |
| InChIKey | PVNDGNZFESEFAM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.11 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene?
The IUPAC name of 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene (CID 102052845) is 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene.
What is the SMILES notation for 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene?
The canonical SMILES for 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene is C#CCC1(CC#C)c2cc(Br)ccc2-c2ccc(Br)cc21.
What is the InChIKey of 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene?
The InChIKey is PVNDGNZFESEFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12Br2/c1-3-9-19(10-4-2)17-11-13(20)5-7-15(17)16-8-6-14(21)12-18(16)19/h1-2,5-8,11-12H,9-10H2.
What are the key properties of 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene?
2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene has a molecular weight of 400.11 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dibromo-9,9-bis(prop-2-ynyl)fluorene is sourced from PubChem (CID 102052845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).