C12H18F3NO3 — CID 102052929
tert-butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate (PubChem CID 102052929) has the molecular formula C12H18F3NO3 and a molecular weight of 281.27 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate.
| Compound Name | tert-butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
|---|---|
| PubChem CID | 102052929 |
| Molecular Formula | C12H18F3NO3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | tert-butyl (2S,3S)-3-methyl-2-[(2,2,2-trifluoroacetyl)amino]pent-4-enoate |
| SMILES | C=C[C@H](C)[C@H](NC(=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H18F3NO3/c1-6-7(2)8(9(17)19-11(3,4)5)16-10(18)12(13,14)15/h6-8H,1H2,2-5H3,(H,16,18)/t7-,8-/m0/s1 |
| InChIKey | REFRVGWLGAGIHI-YUMQZZPRSA-N |
| XLogP | 2.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|