C18H20N6O6 — CID 102053162
1-azido-3-(3-azido-2,5,6-trimethoxyphenyl)-2,4,5-trimethoxybenzene (PubChem CID 102053162) has the molecular formula C18H20N6O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is 1-azido-3-(3-azido-2,5,6-trimethoxyphenyl)-2,4,5-trimethoxybenzene.
| Compound Name | 1-azido-3-(3-azido-2,5,6-trimethoxyphenyl)-2,4,5-trimethoxybenzene |
|---|---|
| PubChem CID | 102053162 |
| Molecular Formula | C18H20N6O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-azido-3-(3-azido-2,5,6-trimethoxyphenyl)-2,4,5-trimethoxybenzene |
| SMILES | COc1cc(N=[N+]=[N-])c(OC)c(-c2c(OC)c(N=[N+]=[N-])cc(OC)c2OC)c1OC |
| InChI | InChI=1S/C18H20N6O6/c1-25-11-7-9(21-23-19)15(27-3)13(17(11)29-5)14-16(28-4)10(22-24-20)8-12(26-2)18(14)30-6/h7-8H,1-6H3 |
| InChIKey | JXDWYAIRFWMTHJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 152.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|