C20H34O5Si — CID 102053682
methyl (3aR,4S,6aR)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-3a,4,6,6a-tetrahydro-3H-pentalene-1-carboxylate (PubChem CID 102053682) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is methyl (3aR,4S,6aR)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-3a,4,6,6a-tetrahydro-3H-pentalene-1-carboxylate.
| Compound Name | methyl (3aR,4S,6aR)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-3a,4,6,6a-tetrahydro-3H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 102053682 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | methyl (3aR,4S,6aR)-2-acetyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5,5-dimethyl-3a,4,6,6a-tetrahydro-3H-pentalene-1-carboxylate |
| SMILES | COC(=O)C1=C(OC(C)=O)C[C@@H]2[C@H]1CC(C)(C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O5Si/c1-12(21)24-15-10-13-14(16(15)18(22)23-7)11-20(5,6)17(13)25-26(8,9)19(2,3)4/h13-14,17H,10-11H2,1-9H3/t13-,14-,17+/m1/s1 |
| InChIKey | HBVYRFDNAZASNM-CPUCHLNUSA-N |
| XLogP | 4.43 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|