C22H23NO5 — CID 102053910
methyl 3-[5-(1,3-dioxoisoindol-2-yl)-2-methoxypentyl]benzoate (PubChem CID 102053910) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 3-[5-(1,3-dioxoisoindol-2-yl)-2-methoxypentyl]benzoate.
| Compound Name | methyl 3-[5-(1,3-dioxoisoindol-2-yl)-2-methoxypentyl]benzoate |
|---|---|
| PubChem CID | 102053910 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 3-[5-(1,3-dioxoisoindol-2-yl)-2-methoxypentyl]benzoate |
| SMILES | COC(=O)c1cccc(CC(CCCN2C(=O)c3ccccc3C2=O)OC)c1 |
| InChI | InChI=1S/C22H23NO5/c1-27-17(14-15-7-5-8-16(13-15)22(26)28-2)9-6-12-23-20(24)18-10-3-4-11-19(18)21(23)25/h3-5,7-8,10-11,13,17H,6,9,12,14H2,1-2H3 |
| InChIKey | AUYZMCUBYCRHSQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|