C18H22N2O — CID 102054361
(1R,11bR)-1-ethyl-10,11b-dimethyl-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indol-3-one (PubChem CID 102054361) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is (1R,11bR)-1-ethyl-10,11b-dimethyl-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indol-3-one.
| Compound Name | (1R,11bR)-1-ethyl-10,11b-dimethyl-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indol-3-one |
|---|---|
| PubChem CID | 102054361 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | (1R,11bR)-1-ethyl-10,11b-dimethyl-2,5,6,11-tetrahydro-1H-indolizino[8,7-b]indol-3-one |
| SMILES | CC[C@@H]1CC(=O)N2CCc3c([nH]c4c(C)cccc34)[C@@]12C |
| InChI | InChI=1S/C18H22N2O/c1-4-12-10-15(21)20-9-8-14-13-7-5-6-11(2)16(13)19-17(14)18(12,20)3/h5-7,12,19H,4,8-10H2,1-3H3/t12-,18-/m1/s1 |
| InChIKey | WHKSNJOTOWYQKM-KZULUSFZSA-N |
| XLogP | 3.51 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |