C23H30ClNO5 — CID 102054409
dimethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate (PubChem CID 102054409) has the molecular formula C23H30ClNO5 and a molecular weight of 435.95 g/mol. Its IUPAC name is dimethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate.
| Compound Name | dimethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102054409 |
| Molecular Formula | C23H30ClNO5 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | dimethyl 2-(chloromethyl)-2-phenyl-5-(2,4,4-trimethylpentan-2-ylimino)furan-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(CCl)(c2ccccc2)O/C1=N\C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C23H30ClNO5/c1-21(2,3)13-22(4,5)25-18-16(19(26)28-6)17(20(27)29-7)23(14-24,30-18)15-11-9-8-10-12-15/h8-12H,13-14H2,1-7H3/b25-18- |
| InChIKey | JWCHHXCMSQZTHL-BWAHOGKJSA-N |
| XLogP | 4.41 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|