C35H44N2O6 — CID 102054500
[(1S,5R,9S,13R,15R)-5-ethoxycarbonyl-5,9,13-trimethyl-14-(pyridine-3-carbonyloxy)-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl pyridine-3-carboxylate (PubChem CID 102054500) has the molecular formula C35H44N2O6 and a molecular weight of 588.75 g/mol. Its IUPAC name is [(1S,5R,9S,13R,15R)-5-ethoxycarbonyl-5,9,13-trimethyl-14-(pyridine-3-carbonyloxy)-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl pyridine-3-carboxylate.
| Compound Name | [(1S,5R,9S,13R,15R)-5-ethoxycarbonyl-5,9,13-trimethyl-14-(pyridine-3-carbonyloxy)-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102054500 |
| Molecular Formula | C35H44N2O6 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.32 |
| IUPAC Name | [(1S,5R,9S,13R,15R)-5-ethoxycarbonyl-5,9,13-trimethyl-14-(pyridine-3-carbonyloxy)-15-tetracyclo[11.2.1.01,10.04,9]hexadecanyl]methyl pyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)CCC[C@@]2(C)C3CC[C@]4(C)C[C@]3(CCC21)[C@H](COC(=O)c1cccnc1)C4OC(=O)c1cccnc1 |
| InChI | InChI=1S/C35H44N2O6/c1-5-41-31(40)34(4)14-8-13-33(3)26(34)12-16-35-22-32(2,15-11-27(33)35)28(43-30(39)24-10-7-18-37-20-24)25(35)21-42-29(38)23-9-6-17-36-19-23/h6-7,9-10,17-20,25-28H,5,8,11-16,21-22H2,1-4H3/t25-,26?,27?,28?,32-,33-,34-,35-/m1/s1 |
| InChIKey | UBBMOFUYRKIACN-MHXSQXOTSA-N |
| XLogP | 6.45 |
| TPSA | 104.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|