About diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate
diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 102055410) has the molecular formula C20H34F2O4Si
and a molecular weight of 404.57 g/mol. Its IUPAC name is diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate |
| PubChem CID | 102055410 |
| Molecular Formula | C20H34F2O4Si |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C=C(C(C)[Si](CC)(CC)CC)C(C(F)F)C1 |
| InChI | InChI=1S/C20H34F2O4Si/c1-7-25-18(23)20(19(24)26-8-2)12-15(16(13-20)17(21)22)14(6)27(9-3,10-4)11-5/h12,14,16-17H,7-11,13H2,1-6H3 |
| InChIKey | GCDDBXRAFOTBLX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate?
The IUPAC name of diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate (CID 102055410) is diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate.
What is the SMILES notation for diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate?
The canonical SMILES for diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate is CCOC(=O)C1(C(=O)OCC)C=C(C(C)[Si](CC)(CC)CC)C(C(F)F)C1.
What is the InChIKey of diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate?
The InChIKey is GCDDBXRAFOTBLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34F2O4Si/c1-7-25-18(23)20(19(24)26-8-2)12-15(16(13-20)17(21)22)14(6)27(9-3,10-4)11-5/h12,14,16-17H,7-11,13H2,1-6H3.
What are the key properties of diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate?
diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate has a molecular weight of 404.57 g/mol, XLogP of 5.21, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 4-(difluoromethyl)-3-(1-triethylsilylethyl)cyclopent-2-ene-1,1-dicarboxylate is sourced from PubChem (CID 102055410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).