C19H34F2O7Si2 — CID 102055419
diethyl 4-(difluoromethyl)-3-[trimethoxysilyl(trimethylsilyl)methyl]cyclopent-2-ene-1,1-dicarboxylate (PubChem CID 102055419) has the molecular formula C19H34F2O7Si2 and a molecular weight of 468.64 g/mol. Its IUPAC name is diethyl 4-(difluoromethyl)-3-[trimethoxysilyl(trimethylsilyl)methyl]cyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | diethyl 4-(difluoromethyl)-3-[trimethoxysilyl(trimethylsilyl)methyl]cyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102055419 |
| Molecular Formula | C19H34F2O7Si2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | diethyl 4-(difluoromethyl)-3-[trimethoxysilyl(trimethylsilyl)methyl]cyclopent-2-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C=C(C([Si](C)(C)C)[Si](OC)(OC)OC)C(C(F)F)C1 |
| InChI | InChI=1S/C19H34F2O7Si2/c1-9-27-17(22)19(18(23)28-10-2)11-13(15(20)21)14(12-19)16(29(6,7)8)30(24-3,25-4)26-5/h12-13,15-16H,9-11H2,1-8H3 |
| InChIKey | SQEKEXBTVDKEGV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|