C24H37FN8O — CID 10205557
4-N,6-N-bis[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 10205557) has the molecular formula C24H37FN8O and a molecular weight of 472.61 g/mol. Its IUPAC name is 4-N,6-N-bis[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-bis[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 10205557 |
| Molecular Formula | C24H37FN8O |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 4-N,6-N-bis[(1-ethylpyrrolidin-2-yl)methyl]-2-N-(3-fluoro-4-methoxyphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN1CCCC1CNc1nc(NCC2CCCN2CC)nc(Nc2ccc(OC)c(F)c2)n1 |
| InChI | InChI=1S/C24H37FN8O/c1-4-32-12-6-8-18(32)15-26-22-29-23(27-16-19-9-7-13-33(19)5-2)31-24(30-22)28-17-10-11-21(34-3)20(25)14-17/h10-11,14,18-19H,4-9,12-13,15-16H2,1-3H3,(H3,26,27,28,29,30,31) |
| InChIKey | USEHORQCLBLLOR-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 90.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |