C18H19N3O4 — CID 102056068
(3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2,2-dimethylhydrazinyl)-3-phenoxyazetidin-2-one (PubChem CID 102056068) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2,2-dimethylhydrazinyl)-3-phenoxyazetidin-2-one.
| Compound Name | (3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2,2-dimethylhydrazinyl)-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 102056068 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3S,4R)-4-(1,3-benzodioxol-5-yl)-1-(2,2-dimethylhydrazinyl)-3-phenoxyazetidin-2-one |
| SMILES | CN(C)NN1C(=O)[C@@H](Oc2ccccc2)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H19N3O4/c1-20(2)19-21-16(12-8-9-14-15(10-12)24-11-23-14)17(18(21)22)25-13-6-4-3-5-7-13/h3-10,16-17,19H,11H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | UUBXKSCJTRVUOP-SJORKVTESA-N |
| XLogP | 1.73 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|