About (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one
(3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one (PubChem CID 102056076) has the molecular formula C13H19N3O2
and a molecular weight of 249.31 g/mol. Its IUPAC name is (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one.
Molecular Properties
| Compound Name | (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one |
| PubChem CID | 102056076 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one |
| SMILES | CN(C)NN1C(=O)[C@@H](Oc2ccccc2)C1(C)C |
| InChI | InChI=1S/C13H19N3O2/c1-13(2)11(12(17)16(13)14-15(3)4)18-10-8-6-5-7-9-10/h5-9,11,14H,1-4H3/t11-/m1/s1 |
| InChIKey | MWTCQRSINSGOOO-LLVKDONJSA-N |
| XLogP | 1.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one?
The IUPAC name of (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one (CID 102056076) is (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one.
What is the SMILES notation for (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one?
The canonical SMILES for (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one is CN(C)NN1C(=O)[C@@H](Oc2ccccc2)C1(C)C.
What is the InChIKey of (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one?
The InChIKey is MWTCQRSINSGOOO-LLVKDONJSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-13(2)11(12(17)16(13)14-15(3)4)18-10-8-6-5-7-9-10/h5-9,11,14H,1-4H3/t11-/m1/s1.
What are the key properties of (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one?
(3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one has a molecular weight of 249.31 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(2,2-dimethylhydrazinyl)-4,4-dimethyl-3-phenoxyazetidin-2-one is sourced from PubChem (CID 102056076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).