C8H15NO4 — CID 102056099
(1R,2S,3R,5S,6R)-5-methyl-8-azabicyclo[3.2.1]octane-1,2,3,6-tetrol (PubChem CID 102056099) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is (1R,2S,3R,5S,6R)-5-methyl-8-azabicyclo[3.2.1]octane-1,2,3,6-tetrol.
| Compound Name | (1R,2S,3R,5S,6R)-5-methyl-8-azabicyclo[3.2.1]octane-1,2,3,6-tetrol |
|---|---|
| PubChem CID | 102056099 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | (1R,2S,3R,5S,6R)-5-methyl-8-azabicyclo[3.2.1]octane-1,2,3,6-tetrol |
| SMILES | C[C@]12C[C@@H](O)[C@H](O)[C@](O)(C[C@H]1O)N2 |
| InChI | InChI=1S/C8H15NO4/c1-7-2-4(10)6(12)8(13,9-7)3-5(7)11/h4-6,9-13H,2-3H2,1H3/t4-,5-,6+,7+,8-/m1/s1 |
| InChIKey | WWGMSAFAAXKRQR-QQGCVABSSA-N |
| XLogP | -2.09 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |