C8H12O2 — CID 102056607
(3S,4R,5R)-5-ethenyl-3,4-dimethyloxolan-2-one (PubChem CID 102056607) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (3S,4R,5R)-5-ethenyl-3,4-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-ethenyl-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 102056607 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (3S,4R,5R)-5-ethenyl-3,4-dimethyloxolan-2-one |
| SMILES | C=C[C@H]1OC(=O)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C8H12O2/c1-4-7-5(2)6(3)8(9)10-7/h4-7H,1H2,2-3H3/t5-,6+,7-/m1/s1 |
| InChIKey | MULPDBNZOLXMNS-DSYKOEDSSA-N |
| XLogP | 1.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|