C13H17NO5 — CID 102056731
(3aS,7S,9S,9aR,9bR)-7,9-dimethoxy-4,7,8,9,9a,9b-hexahydro-3aH-pyrano[3,2-e]isoindole-1,3-dione (PubChem CID 102056731) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is (3aS,7S,9S,9aR,9bR)-7,9-dimethoxy-4,7,8,9,9a,9b-hexahydro-3aH-pyrano[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,7S,9S,9aR,9bR)-7,9-dimethoxy-4,7,8,9,9a,9b-hexahydro-3aH-pyrano[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 102056731 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (3aS,7S,9S,9aR,9bR)-7,9-dimethoxy-4,7,8,9,9a,9b-hexahydro-3aH-pyrano[3,2-e]isoindole-1,3-dione |
| SMILES | CO[C@@H]1C[C@H](OC)[C@@H]2C(=CC[C@@H]3C(=O)NC(=O)[C@H]23)O1 |
| InChI | InChI=1S/C13H17NO5/c1-17-8-5-9(18-2)19-7-4-3-6-10(11(7)8)13(16)14-12(6)15/h4,6,8-11H,3,5H2,1-2H3,(H,14,15,16)/t6-,8-,9-,10-,11-/m0/s1 |
| InChIKey | FPQRLVCAAUXAMR-GUVHNANBSA-N |
| XLogP | 0.19 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|