C13H18N2O2 — CID 102056795
(3aS,7aS)-2,5-bis(prop-2-enyl)-3a,4,7,7a-tetrahydro-3H-pyrrolo[3,4-c]pyridine-1,6-dione (PubChem CID 102056795) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is (3aS,7aS)-2,5-bis(prop-2-enyl)-3a,4,7,7a-tetrahydro-3H-pyrrolo[3,4-c]pyridine-1,6-dione.
| Compound Name | (3aS,7aS)-2,5-bis(prop-2-enyl)-3a,4,7,7a-tetrahydro-3H-pyrrolo[3,4-c]pyridine-1,6-dione |
|---|---|
| PubChem CID | 102056795 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (3aS,7aS)-2,5-bis(prop-2-enyl)-3a,4,7,7a-tetrahydro-3H-pyrrolo[3,4-c]pyridine-1,6-dione |
| SMILES | C=CCN1C[C@H]2CN(CC=C)C(=O)[C@H]2CC1=O |
| InChI | InChI=1S/C13H18N2O2/c1-3-5-14-8-10-9-15(6-4-2)13(17)11(10)7-12(14)16/h3-4,10-11H,1-2,5-9H2/t10-,11-/m0/s1 |
| InChIKey | AWILWGPOEUCZIF-QWRGUYRKSA-N |
| XLogP | 0.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|