About methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate
methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate (PubChem CID 102057421) has the molecular formula C14H22O4
and a molecular weight of 254.33 g/mol. Its IUPAC name is methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate.
Molecular Properties
| Compound Name | methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate |
| PubChem CID | 102057421 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate |
| SMILES | COC(=O)C(O)(CC(C)=O)C/C(C)=C/C=C(C)C |
| InChI | InChI=1S/C14H22O4/c1-10(2)6-7-11(3)8-14(17,9-12(4)15)13(16)18-5/h6-7,17H,8-9H2,1-5H3/b11-7+ |
| InChIKey | XTDPYCLTMXXXSQ-YRNVUSSQSA-N |
| XLogP | 2.17 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate?
The IUPAC name of methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate (CID 102057421) is methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate.
What is the SMILES notation for methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate?
The canonical SMILES for methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate is COC(=O)C(O)(CC(C)=O)C/C(C)=C/C=C(C)C.
What is the InChIKey of methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate?
The InChIKey is XTDPYCLTMXXXSQ-YRNVUSSQSA-N. The full InChI is InChI=1S/C14H22O4/c1-10(2)6-7-11(3)8-14(17,9-12(4)15)13(16)18-5/h6-7,17H,8-9H2,1-5H3/b11-7+.
What are the key properties of methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate?
methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate has a molecular weight of 254.33 g/mol, XLogP of 2.17, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4E)-2-hydroxy-4,7-dimethyl-2-(2-oxopropyl)octa-4,6-dienoate is sourced from PubChem (CID 102057421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).