C17H22O3S — CID 102058091
(4aS,8R,8aS)-8-(benzenesulfonyl)-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-4a-ol (PubChem CID 102058091) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is (4aS,8R,8aS)-8-(benzenesulfonyl)-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-4a-ol.
| Compound Name | (4aS,8R,8aS)-8-(benzenesulfonyl)-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-4a-ol |
|---|---|
| PubChem CID | 102058091 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (4aS,8R,8aS)-8-(benzenesulfonyl)-5-methylidene-1,2,3,4,6,7,8,8a-octahydronaphthalen-4a-ol |
| SMILES | C=C1CC[C@@H](S(=O)(=O)c2ccccc2)[C@H]2CCCC[C@@]12O |
| InChI | InChI=1S/C17H22O3S/c1-13-10-11-16(15-9-5-6-12-17(13,15)18)21(19,20)14-7-3-2-4-8-14/h2-4,7-8,15-16,18H,1,5-6,9-12H2/t15-,16-,17-/m1/s1 |
| InChIKey | YXZVVWKWMJJCHX-BRWVUGGUSA-N |
| XLogP | 3.10 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|