C18H28N4O9S — CID 10205814
2-amino-5-[[1-(carboxymethylamino)-3-[(2E)-3-ethoxy-3-oxo-2-prop-2-enoxyiminopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 10205814) has the molecular formula C18H28N4O9S and a molecular weight of 476.51 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-3-[(2E)-3-ethoxy-3-oxo-2-prop-2-enoxyiminopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-3-[(2E)-3-ethoxy-3-oxo-2-prop-2-enoxyiminopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10205814 |
| Molecular Formula | C18H28N4O9S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-3-[(2E)-3-ethoxy-3-oxo-2-prop-2-enoxyiminopropyl]sulfanyl-1-oxopropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | C=CCO/N=C(/CSCC(NC(=O)CCC(N)C(=O)O)C(=O)NCC(=O)O)C(=O)OCC |
| InChI | InChI=1S/C18H28N4O9S/c1-3-7-31-22-13(18(29)30-4-2)10-32-9-12(16(26)20-8-15(24)25)21-14(23)6-5-11(19)17(27)28/h3,11-12H,1,4-10,19H2,2H3,(H,20,26)(H,21,23)(H,24,25)(H,27,28)/b22-13- |
| InChIKey | XIYRDKITMSLPHF-XKZIYDEJSA-N |
| XLogP | -1.28 |
| TPSA | 206.71 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|