C33H24N4 — CID 10205835
4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline (PubChem CID 10205835) has the molecular formula C33H24N4 and a molecular weight of 476.58 g/mol. Its IUPAC name is 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline.
| Compound Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 10205835 |
| Molecular Formula | C33H24N4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 4-(4,6-diphenyl-1,3,5-triazin-2-yl)-N,N-diphenylaniline |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(N(c4ccccc4)c4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C33H24N4/c1-5-13-25(14-6-1)31-34-32(26-15-7-2-8-16-26)36-33(35-31)27-21-23-30(24-22-27)37(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-24H |
| InChIKey | SSTXLHRIIOMGDH-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |