C12H21NO3 — CID 102058881
(2S)-2-amino-2-[(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-1-ol (PubChem CID 102058881) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (2S)-2-amino-2-[(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-1-ol.
| Compound Name | (2S)-2-amino-2-[(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-1-ol |
|---|---|
| PubChem CID | 102058881 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (2S)-2-amino-2-[(1S,2S,4S)-7,7-dimethoxy-2-bicyclo[2.2.1]hept-5-enyl]propan-1-ol |
| SMILES | COC1(OC)[C@@H]2C=C[C@H]1[C@@H]([C@](C)(N)CO)C2 |
| InChI | InChI=1S/C12H21NO3/c1-11(13,7-14)10-6-8-4-5-9(10)12(8,15-2)16-3/h4-5,8-10,14H,6-7,13H2,1-3H3/t8-,9+,10+,11-/m1/s1 |
| InChIKey | JYSJAEKVNNAEAN-VPOLOUISSA-N |
| XLogP | 0.51 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|