C18H17NO6 — CID 102058951
ethyl (1S,6S)-8-(1,3-benzodioxol-5-yl)-6-hydroxy-9-oxo-7-azabicyclo[4.2.1]nona-3,7-diene-1-carboxylate (PubChem CID 102058951) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is ethyl (1S,6S)-8-(1,3-benzodioxol-5-yl)-6-hydroxy-9-oxo-7-azabicyclo[4.2.1]nona-3,7-diene-1-carboxylate.
| Compound Name | ethyl (1S,6S)-8-(1,3-benzodioxol-5-yl)-6-hydroxy-9-oxo-7-azabicyclo[4.2.1]nona-3,7-diene-1-carboxylate |
|---|---|
| PubChem CID | 102058951 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethyl (1S,6S)-8-(1,3-benzodioxol-5-yl)-6-hydroxy-9-oxo-7-azabicyclo[4.2.1]nona-3,7-diene-1-carboxylate |
| SMILES | CCOC(=O)[C@@]12CC=CC[C@@](O)(N=C1c1ccc3c(c1)OCO3)C2=O |
| InChI | InChI=1S/C18H17NO6/c1-2-23-16(21)17-7-3-4-8-18(22,15(17)20)19-14(17)11-5-6-12-13(9-11)25-10-24-12/h3-6,9,22H,2,7-8,10H2,1H3/t17-,18-/m0/s1 |
| InChIKey | QKPJTZULLMCQDD-ROUUACIJSA-N |
| XLogP | 1.38 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|