C17H19NO3 — CID 102058964
ethyl (3R)-2-oxo-6-phenyl-3-[(E)-prop-1-enyl]-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 102058964) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl (3R)-2-oxo-6-phenyl-3-[(E)-prop-1-enyl]-3,4-dihydro-1H-pyridine-5-carboxylate.
| Compound Name | ethyl (3R)-2-oxo-6-phenyl-3-[(E)-prop-1-enyl]-3,4-dihydro-1H-pyridine-5-carboxylate |
|---|---|
| PubChem CID | 102058964 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | ethyl (3R)-2-oxo-6-phenyl-3-[(E)-prop-1-enyl]-3,4-dihydro-1H-pyridine-5-carboxylate |
| SMILES | C/C=C/[C@H]1CC(C(=O)OCC)=C(c2ccccc2)NC1=O |
| InChI | InChI=1S/C17H19NO3/c1-3-8-13-11-14(17(20)21-4-2)15(18-16(13)19)12-9-6-5-7-10-12/h3,5-10,13H,4,11H2,1-2H3,(H,18,19)/b8-3+/t13-/m0/s1 |
| InChIKey | VWADDGOISNVOKG-UTPRNQHHSA-N |
| XLogP | 2.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|