C16H24O2 — CID 102059008
(1R,2R,9S,10S)-tricyclo[8.6.0.02,9]hexadecane-3,16-dione (PubChem CID 102059008) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1R,2R,9S,10S)-tricyclo[8.6.0.02,9]hexadecane-3,16-dione.
| Compound Name | (1R,2R,9S,10S)-tricyclo[8.6.0.02,9]hexadecane-3,16-dione |
|---|---|
| PubChem CID | 102059008 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1R,2R,9S,10S)-tricyclo[8.6.0.02,9]hexadecane-3,16-dione |
| SMILES | O=C1CCCCC[C@H]2[C@@H]3CCCCCC(=O)[C@H]3[C@H]12 |
| InChI | InChI=1S/C16H24O2/c17-13-9-5-1-3-7-11-12-8-4-2-6-10-14(18)16(12)15(11)13/h11-12,15-16H,1-10H2/t11-,12-,15-,16-/m0/s1 |
| InChIKey | ZFJBZLNPWBMAST-APYUEPQZSA-N |
| XLogP | 3.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |