C11H14O2 — CID 102059439
(9S)-9-ethoxybicyclo[3.2.2]nona-3,6-dien-2-one (PubChem CID 102059439) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is (9S)-9-ethoxybicyclo[3.2.2]nona-3,6-dien-2-one.
| Compound Name | (9S)-9-ethoxybicyclo[3.2.2]nona-3,6-dien-2-one |
|---|---|
| PubChem CID | 102059439 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | (9S)-9-ethoxybicyclo[3.2.2]nona-3,6-dien-2-one |
| SMILES | CCO[C@H]1CC2C=CC1C=CC2=O |
| InChI | InChI=1S/C11H14O2/c1-2-13-11-7-9-4-3-8(11)5-6-10(9)12/h3-6,8-9,11H,2,7H2,1H3/t8?,9?,11-/m0/s1 |
| InChIKey | XVWLADGUQBVPQG-AMUVOQDHSA-N |
| XLogP | 1.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|