C21H18N2O2 — CID 102059616
(3aS,5S,10cS)-5-methyl-2-phenyl-4,5,6,10c-tetrahydro-3aH-pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 102059616) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is (3aS,5S,10cS)-5-methyl-2-phenyl-4,5,6,10c-tetrahydro-3aH-pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | (3aS,5S,10cS)-5-methyl-2-phenyl-4,5,6,10c-tetrahydro-3aH-pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 102059616 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | (3aS,5S,10cS)-5-methyl-2-phenyl-4,5,6,10c-tetrahydro-3aH-pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | C[C@H]1C[C@@H]2C(=O)N(c3ccccc3)C(=O)[C@@H]2c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C21H18N2O2/c1-12-11-15-18(17-14-9-5-6-10-16(14)22-19(12)17)21(25)23(20(15)24)13-7-3-2-4-8-13/h2-10,12,15,18,22H,11H2,1H3/t12-,15-,18-/m0/s1 |
| InChIKey | DOYUEFLUMUQKLA-QITLCBANSA-N |
| XLogP | 3.95 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|