C30H50 — CID 102059660
(17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 102059660) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 102059660 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (17S)-4,4,10,13,14-pentamethyl-17-[(2R)-6-methylhept-5-en-2-yl]-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)=CCC[C@@H](C)[C@@H]1CCC2(C)C3=CCC4C(C)(C)CCCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H50/c1-21(2)11-9-12-22(3)23-15-19-30(8)25-13-14-26-27(4,5)17-10-18-28(26,6)24(25)16-20-29(23,30)7/h11,13,22-24,26H,9-10,12,14-20H2,1-8H3/t22-,23+,24?,26?,28?,29?,30?/m1/s1 |
| InChIKey | SZLHPSKURYFPPQ-SPQPXZFSSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|