C8H16O8 — CID 102060354
(3S,4S,5R,6R,7R)-1,3,4,5,6,7,8-heptahydroxyoctan-2-one (PubChem CID 102060354) has the molecular formula C8H16O8 and a molecular weight of 240.21 g/mol. Its IUPAC name is (3S,4S,5R,6R,7R)-1,3,4,5,6,7,8-heptahydroxyoctan-2-one.
| Compound Name | (3S,4S,5R,6R,7R)-1,3,4,5,6,7,8-heptahydroxyoctan-2-one |
|---|---|
| PubChem CID | 102060354 |
| Molecular Formula | C8H16O8 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (3S,4S,5R,6R,7R)-1,3,4,5,6,7,8-heptahydroxyoctan-2-one |
| SMILES | O=C(CO)[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C8H16O8/c9-1-3(11)5(13)7(15)8(16)6(14)4(12)2-10/h3,5-11,13-16H,1-2H2/t3-,5-,6-,7-,8-/m1/s1 |
| InChIKey | KSHYQYHHIKNYAY-PNAXYBNRSA-N |
| XLogP | -4.66 |
| TPSA | 158.68 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -4.66 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |