C18H15ClO — CID 102060619
(15S)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl chloride (PubChem CID 102060619) has the molecular formula C18H15ClO and a molecular weight of 282.77 g/mol. Its IUPAC name is (15S)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl chloride.
| Compound Name | (15S)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl chloride |
|---|---|
| PubChem CID | 102060619 |
| Molecular Formula | C18H15ClO |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (15S)-15-methyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene-15-carbonyl chloride |
| SMILES | C[C@]1(C(=O)Cl)CC2c3ccccc3C1c1ccccc12 |
| InChI | InChI=1S/C18H15ClO/c1-18(17(19)20)10-15-11-6-2-4-8-13(11)16(18)14-9-5-3-7-12(14)15/h2-9,15-16H,10H2,1H3/t15?,16?,18-/m0/s1 |
| InChIKey | YPSXHCFSCCJWBX-HTWSVDAQSA-N |
| XLogP | 4.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|