C27H36N8O4 — CID 102060644
(2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-N-[(2S)-1-(2-cyanoethylamino)-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide (PubChem CID 102060644) has the molecular formula C27H36N8O4 and a molecular weight of 536.64 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-N-[(2S)-1-(2-cyanoethylamino)-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide.
| Compound Name | (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-N-[(2S)-1-(2-cyanoethylamino)-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide |
|---|---|
| PubChem CID | 102060644 |
| Molecular Formula | C27H36N8O4 |
| Molecular Weight | 536.64 g/mol |
| Exact Mass | 536.29 |
| IUPAC Name | (2R)-2-[[(2S)-2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-N-[(2S)-1-(2-cyanoethylamino)-1-oxo-3-phenylpropan-2-yl]-5-(diaminomethylideneamino)pentanamide |
| SMILES | N#CCCNC(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](CCCN=C(N)N)NC(=O)[C@@H](N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H36N8O4/c28-13-5-15-32-25(38)23(17-18-6-2-1-3-7-18)35-26(39)22(8-4-14-33-27(30)31)34-24(37)21(29)16-19-9-11-20(36)12-10-19/h1-3,6-7,9-12,21-23,36H,4-5,8,14-17,29H2,(H,32,38)(H,34,37)(H,35,39)(H4,30,31,33)/t21-,22+,23-/m0/s1 |
| InChIKey | OHRVHFKJCSRLGY-ZRBLBEILSA-N |
| XLogP | -0.44 |
| TPSA | 221.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.64 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|