C26H28N2O5S — CID 10206072
[5-[4-[2-(dimethylamino)ethoxy]phenyl]-6-(4-hydroxyphenyl)-7,8-dihydronaphthalen-2-yl] sulfamate (PubChem CID 10206072) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is [5-[4-[2-(dimethylamino)ethoxy]phenyl]-6-(4-hydroxyphenyl)-7,8-dihydronaphthalen-2-yl] sulfamate.
| Compound Name | [5-[4-[2-(dimethylamino)ethoxy]phenyl]-6-(4-hydroxyphenyl)-7,8-dihydronaphthalen-2-yl] sulfamate |
|---|---|
| PubChem CID | 10206072 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [5-[4-[2-(dimethylamino)ethoxy]phenyl]-6-(4-hydroxyphenyl)-7,8-dihydronaphthalen-2-yl] sulfamate |
| SMILES | CN(C)CCOc1ccc(C2=C(c3ccc(O)cc3)CCc3cc(OS(N)(=O)=O)ccc32)cc1 |
| InChI | InChI=1S/C26H28N2O5S/c1-28(2)15-16-32-22-10-5-19(6-11-22)26-24(18-3-8-21(29)9-4-18)13-7-20-17-23(12-14-25(20)26)33-34(27,30)31/h3-6,8-12,14,17,29H,7,13,15-16H2,1-2H3,(H2,27,30,31) |
| InChIKey | XCZRTEULZCMLCQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|