C21H32O5 — CID 102061980
[(1S,2R,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 102061980) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [(1S,2R,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | [(1S,2R,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 102061980 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [(1S,2R,5R)-5-methyl-1-pentyl-6-oxabicyclo[3.1.0]hexan-2-yl] (1S,4S)-4,7,7-trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CCCCC[C@@]12O[C@]1(C)CC[C@H]2OC(=O)[C@@]12CC[C@](C)(C(=O)O1)C2(C)C |
| InChI | InChI=1S/C21H32O5/c1-6-7-8-10-20-14(9-11-19(20,5)26-20)24-16(23)21-13-12-18(4,15(22)25-21)17(21,2)3/h14H,6-13H2,1-5H3/t14-,18-,19-,20+,21-/m1/s1 |
| InChIKey | VMPWCHPKMMZZHB-DIDAFVSYSA-N |
| XLogP | 3.92 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|