C14H22F3NO3 — CID 102062049
methyl (2S,4R)-6-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]heptanoate (PubChem CID 102062049) has the molecular formula C14H22F3NO3 and a molecular weight of 309.33 g/mol. Its IUPAC name is methyl (2S,4R)-6-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]heptanoate.
| Compound Name | methyl (2S,4R)-6-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]heptanoate |
|---|---|
| PubChem CID | 102062049 |
| Molecular Formula | C14H22F3NO3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | methyl (2S,4R)-6-methyl-2-prop-2-enyl-4-[(2,2,2-trifluoroacetyl)amino]heptanoate |
| SMILES | C=CCC(C[C@@H](CC(C)C)NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C14H22F3NO3/c1-5-6-10(12(19)21-4)8-11(7-9(2)3)18-13(20)14(15,16)17/h5,9-11H,1,6-8H2,2-4H3,(H,18,20)/t10?,11-/m1/s1 |
| InChIKey | AONHSJIVKQYCKD-RRKGBCIJSA-N |
| XLogP | 2.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|