About 3-(benzenesulfonamido)-1,1-dimethylurea
3-(benzenesulfonamido)-1,1-dimethylurea (PubChem CID 102062156) has the molecular formula C9H13N3O3S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 3-(benzenesulfonamido)-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-(benzenesulfonamido)-1,1-dimethylurea |
| PubChem CID | 102062156 |
| Molecular Formula | C9H13N3O3S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 3-(benzenesulfonamido)-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C9H13N3O3S/c1-12(2)9(13)10-11-16(14,15)8-6-4-3-5-7-8/h3-7,11H,1-2H3,(H,10,13) |
| InChIKey | ATERAPDSKVBHDJ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzenesulfonamido)-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonamido)-1,1-dimethylurea?
The IUPAC name of 3-(benzenesulfonamido)-1,1-dimethylurea (CID 102062156) is 3-(benzenesulfonamido)-1,1-dimethylurea.
What is the SMILES notation for 3-(benzenesulfonamido)-1,1-dimethylurea?
The canonical SMILES for 3-(benzenesulfonamido)-1,1-dimethylurea is CN(C)C(=O)NNS(=O)(=O)c1ccccc1.
What is the InChIKey of 3-(benzenesulfonamido)-1,1-dimethylurea?
The InChIKey is ATERAPDSKVBHDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3S/c1-12(2)9(13)10-11-16(14,15)8-6-4-3-5-7-8/h3-7,11H,1-2H3,(H,10,13).
What are the key properties of 3-(benzenesulfonamido)-1,1-dimethylurea?
3-(benzenesulfonamido)-1,1-dimethylurea has a molecular weight of 243.29 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonamido)-1,1-dimethylurea is sourced from PubChem (CID 102062156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).