C22H34O6Si — CID 102062235
[(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate (PubChem CID 102062235) has the molecular formula C22H34O6Si and a molecular weight of 422.59 g/mol. Its IUPAC name is [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate.
| Compound Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
|---|---|
| PubChem CID | 102062235 |
| Molecular Formula | C22H34O6Si |
| Molecular Weight | 422.59 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | [(3R)-4,4-dimethyl-2-oxooxolan-3-yl] (1R,4R,5R)-3-[tert-butyl(dimethyl)silyl]oxy-4,5-dimethyl-8-oxabicyclo[3.2.1]octa-2,6-diene-2-carboxylate |
| SMILES | C[C@H]1C(O[Si](C)(C)C(C)(C)C)=C(C(=O)O[C@H]2C(=O)OCC2(C)C)[C@H]2C=C[C@@]1(C)O2 |
| InChI | InChI=1S/C22H34O6Si/c1-13-16(28-29(8,9)20(2,3)4)15(14-10-11-22(13,7)27-14)18(23)26-17-19(24)25-12-21(17,5)6/h10-11,13-14,17H,12H2,1-9H3/t13-,14+,17-,22+/m0/s1 |
| InChIKey | MRULHEPDSISHIU-TYGMBGIGSA-N |
| XLogP | 4.12 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.59 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|