About CID 102062250
CID 102062250 (PubChem CID 102062250) has the molecular formula C9H18NO
and a molecular weight of 156.25 g/mol.
Molecular Properties
| Compound Name | CID 102062250 |
| PubChem CID | 102062250 |
| Molecular Formula | C9H18NO |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=N[O])C(C)(C)C |
| InChI | InChI=1S/C9H18NO/c1-8(2,3)7(10-11)9(4,5)6/h1-6H3 |
| InChIKey | SMFKRADJAKWWHU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 102062250 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102062250?
The IUPAC name of CID 102062250 (CID 102062250) is not available.
What is the SMILES notation for CID 102062250?
The canonical SMILES for CID 102062250 is CC(C)(C)C(=N[O])C(C)(C)C.
What is the InChIKey of CID 102062250?
The InChIKey is SMFKRADJAKWWHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO/c1-8(2,3)7(10-11)9(4,5)6/h1-6H3.
What are the key properties of CID 102062250?
CID 102062250 has a molecular weight of 156.25 g/mol, XLogP of 2.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102062250 is sourced from PubChem (CID 102062250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).