C16H24O4 — CID 102062461
diethyl (3aR,7aS)-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate (PubChem CID 102062461) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is diethyl (3aR,7aS)-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate.
| Compound Name | diethyl (3aR,7aS)-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102062461 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | diethyl (3aR,7aS)-3-methylidene-3a,4,5,6,7,7a-hexahydro-2H-indene-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H24O4/c1-4-19-14(17)16(15(18)20-5-2)10-11(3)12-8-6-7-9-13(12)16/h12-13H,3-10H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | QHBXFHYVOYGGNL-STQMWFEESA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|