C24H30N4O2 — CID 1020625
N,N'-bis(4-methylphenyl)-1,2-dimorpholin-4-ylethane-1,2-diimine (PubChem CID 1020625) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is N,N'-bis(4-methylphenyl)-1,2-dimorpholin-4-ylethane-1,2-diimine.
| Compound Name | N,N'-bis(4-methylphenyl)-1,2-dimorpholin-4-ylethane-1,2-diimine |
|---|---|
| PubChem CID | 1020625 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | N,N'-bis(4-methylphenyl)-1,2-dimorpholin-4-ylethane-1,2-diimine |
| SMILES | Cc1ccc(/N=C(C(=N\c2ccc(C)cc2)/N2CCOCC2)\N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H30N4O2/c1-19-3-7-21(8-4-19)25-23(27-11-15-29-16-12-27)24(28-13-17-30-18-14-28)26-22-9-5-20(2)6-10-22/h3-10H,11-18H2,1-2H3/b25-23-,26-24+ |
| InChIKey | IYGASNNFQCVNJB-MJPLYFDISA-N |
| XLogP | 3.73 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|