C14H18O3S — CID 102062575
5-(4-methylphenyl)-2-(methylsulfanylmethyl)-5-oxopentanoic acid (PubChem CID 102062575) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is 5-(4-methylphenyl)-2-(methylsulfanylmethyl)-5-oxopentanoic acid.
| Compound Name | 5-(4-methylphenyl)-2-(methylsulfanylmethyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 102062575 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 5-(4-methylphenyl)-2-(methylsulfanylmethyl)-5-oxopentanoic acid |
| SMILES | CSCC(CCC(=O)c1ccc(C)cc1)C(=O)O |
| InChI | InChI=1S/C14H18O3S/c1-10-3-5-11(6-4-10)13(15)8-7-12(9-18-2)14(16)17/h3-6,12H,7-9H2,1-2H3,(H,16,17) |
| InChIKey | LQMJFQXXRFJKFH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |